C48H47N5OPt-2 — CID 171765781
9-[4-(3-deuteriopentan-3-yl)-2-pyridinyl]-2-[[2-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3H-pyridin-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum (PubChem CID 171765781) has the molecular formula C48H47N5OPt-2 and a molecular weight of 906.02 g/mol. Its IUPAC name is 9-[4-(3-deuteriopentan-3-yl)-2-pyridinyl]-2-[[2-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3H-pyridin-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum.
| Compound Name | 9-[4-(3-deuteriopentan-3-yl)-2-pyridinyl]-2-[[2-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3H-pyridin-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum |
|---|---|
| PubChem CID | 171765781 |
| Molecular Formula | C48H47N5OPt-2 |
| Molecular Weight | 906.02 g/mol |
| Exact Mass | 905.35 |
| IUPAC Name | 9-[4-(3-deuteriopentan-3-yl)-2-pyridinyl]-2-[[2-[3-(3,5-ditert-butylphenyl)-2H-benzimidazol-3-ium-2-id-1-yl]-3H-pyridin-3-id-4-yl]oxy]-1H-carbazol-1-ide;platinum |
| SMILES | [2H]C(CC)(CC)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5[c-][n+](-c6cc(C(C)(C)C)cc(C(C)(C)C)c6)c6ccccc65)ncc4)ccc3c3ccccc32)c1.[Pt] |
| InChI | InChI=1S/C48H47N5O.Pt/c1-9-32(10-2)33-21-23-50-46(25-33)53-41-16-12-11-15-39(41)40-20-19-37(29-44(40)53)54-38-22-24-49-45(30-38)52-31-51(42-17-13-14-18-43(42)52)36-27-34(47(3,4)5)26-35(28-36)48(6,7)8;/h11-28,32H,9-10H2,1-8H3;/q-2;/i32D; |
| InChIKey | SNPIVFUJQJWAJF-KNSAOVQCSA-N |
| XLogP | 11.48 |
| TPSA | 48.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.02 |
| LogP ≤ 5 | 11.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|