C34H36N6O6 — CID 171772432
1-[2-[4-[(4-but-2-enoylpiperazin-1-yl)methyl]-5-hydroxy-1H-indole-2-carbonyl]-1-benzofuran-5-yl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea (PubChem CID 171772432) has the molecular formula C34H36N6O6 and a molecular weight of 624.70 g/mol. Its IUPAC name is 1-[2-[4-[(4-but-2-enoylpiperazin-1-yl)methyl]-5-hydroxy-1H-indole-2-carbonyl]-1-benzofuran-5-yl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea.
| Compound Name | 1-[2-[4-[(4-but-2-enoylpiperazin-1-yl)methyl]-5-hydroxy-1H-indole-2-carbonyl]-1-benzofuran-5-yl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
|---|---|
| PubChem CID | 171772432 |
| Molecular Formula | C34H36N6O6 |
| Molecular Weight | 624.70 g/mol |
| Exact Mass | 624.27 |
| IUPAC Name | 1-[2-[4-[(4-but-2-enoylpiperazin-1-yl)methyl]-5-hydroxy-1H-indole-2-carbonyl]-1-benzofuran-5-yl]-3-(5-tert-butyl-1,2-oxazol-3-yl)urea |
| SMILES | CC=CC(=O)N1CCN(Cc2c(O)ccc3[nH]c(C(=O)c4cc5cc(NC(=O)Nc6cc(C(C)(C)C)on6)ccc5o4)cc23)CC1 |
| InChI | InChI=1S/C34H36N6O6/c1-5-6-31(42)40-13-11-39(12-14-40)19-23-22-17-25(36-24(22)8-9-26(23)41)32(43)28-16-20-15-21(7-10-27(20)45-28)35-33(44)37-30-18-29(46-38-30)34(2,3)4/h5-10,15-18,36,41H,11-14,19H2,1-4H3,(H2,35,37,38,44) |
| InChIKey | KSXGMKSBITZIFO-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 156.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|