C21H23ClFN3 — CID 171773335
4-[2-chloro-5-methyl-3-[(piperidin-3-ylmethylamino)methyl]phenyl]-2-fluorobenzonitrile (PubChem CID 171773335) has the molecular formula C21H23ClFN3 and a molecular weight of 371.89 g/mol. Its IUPAC name is 4-[2-chloro-5-methyl-3-[(piperidin-3-ylmethylamino)methyl]phenyl]-2-fluorobenzonitrile.
| Compound Name | 4-[2-chloro-5-methyl-3-[(piperidin-3-ylmethylamino)methyl]phenyl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 171773335 |
| Molecular Formula | C21H23ClFN3 |
| Molecular Weight | 371.89 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 4-[2-chloro-5-methyl-3-[(piperidin-3-ylmethylamino)methyl]phenyl]-2-fluorobenzonitrile |
| SMILES | Cc1cc(CNCC2CCCNC2)c(Cl)c(-c2ccc(C#N)c(F)c2)c1 |
| InChI | InChI=1S/C21H23ClFN3/c1-14-7-18(13-26-12-15-3-2-6-25-11-15)21(22)19(8-14)16-4-5-17(10-24)20(23)9-16/h4-5,7-9,15,25-26H,2-3,6,11-13H2,1H3 |
| InChIKey | OWFOLKNUGGPFKJ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.89 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |