C11H11BrClN3O4S — CID 171773740
N-[bromomethoxy-(4-chloro-5-methyl-1,2-oxazol-3-yl)methyl]pyridine-3-sulfonamide (PubChem CID 171773740) has the molecular formula C11H11BrClN3O4S and a molecular weight of 396.65 g/mol. Its IUPAC name is N-[bromomethoxy-(4-chloro-5-methyl-1,2-oxazol-3-yl)methyl]pyridine-3-sulfonamide.
| Compound Name | N-[bromomethoxy-(4-chloro-5-methyl-1,2-oxazol-3-yl)methyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 171773740 |
| Molecular Formula | C11H11BrClN3O4S |
| Molecular Weight | 396.65 g/mol |
| Exact Mass | 394.93 |
| IUPAC Name | N-[bromomethoxy-(4-chloro-5-methyl-1,2-oxazol-3-yl)methyl]pyridine-3-sulfonamide |
| SMILES | Cc1onc(C(NS(=O)(=O)c2cccnc2)OCBr)c1Cl |
| InChI | InChI=1S/C11H11BrClN3O4S/c1-7-9(13)10(15-20-7)11(19-6-12)16-21(17,18)8-3-2-4-14-5-8/h2-5,11,16H,6H2,1H3 |
| InChIKey | FNWUSIJFMUGXQR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.65 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|