C11H16Cl2N6O — CID 171774439
2-amino-N-[6-(azidomethyl)-3-pyridinyl]butanamide;dichloromethane (PubChem CID 171774439) has the molecular formula C11H16Cl2N6O and a molecular weight of 319.20 g/mol. Its IUPAC name is 2-amino-N-[6-(azidomethyl)-3-pyridinyl]butanamide;dichloromethane.
| Compound Name | 2-amino-N-[6-(azidomethyl)-3-pyridinyl]butanamide;dichloromethane |
|---|---|
| PubChem CID | 171774439 |
| Molecular Formula | C11H16Cl2N6O |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-amino-N-[6-(azidomethyl)-3-pyridinyl]butanamide;dichloromethane |
| SMILES | CCC(N)C(=O)Nc1ccc(CN=[N+]=[N-])nc1.ClCCl |
| InChI | InChI=1S/C10H14N6O.CH2Cl2/c1-2-9(11)10(17)15-8-4-3-7(13-5-8)6-14-16-12;2-1-3/h3-5,9H,2,6,11H2,1H3,(H,15,17);1H2 |
| InChIKey | NARJXAUPULLZNX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|