C23H37N9O8 — CID 165430098
3-[2-[2-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[6-(azidomethyl)-3-pyridinyl]propanamide (PubChem CID 165430098) has the molecular formula C23H37N9O8 and a molecular weight of 567.60 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[6-(azidomethyl)-3-pyridinyl]propanamide.
| Compound Name | 3-[2-[2-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[6-(azidomethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 165430098 |
| Molecular Formula | C23H37N9O8 |
| Molecular Weight | 567.60 g/mol |
| Exact Mass | 567.28 |
| IUPAC Name | 3-[2-[2-[2-[2-[[2-[[2-[(2-aminoacetyl)amino]acetyl]amino]acetyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]-N-[6-(azidomethyl)-3-pyridinyl]propanamide |
| SMILES | [N-]=[N+]=NCc1ccc(NC(=O)CCOCCOCCOCCOCCNC(=O)CNC(=O)CNC(=O)CN)cn1 |
| InChI | InChI=1S/C23H37N9O8/c24-13-21(34)28-17-23(36)29-16-22(35)26-4-6-38-8-10-40-12-11-39-9-7-37-5-3-20(33)31-19-2-1-18(27-14-19)15-30-32-25/h1-2,14H,3-13,15-17,24H2,(H,26,35)(H,28,34)(H,29,36)(H,31,33) |
| InChIKey | XEDFAGXGOHSZMV-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 240.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.60 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|