C9H14N2OS — CID 171774639
(3R,5S)-5-methyl-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol (PubChem CID 171774639) has the molecular formula C9H14N2OS and a molecular weight of 198.29 g/mol. Its IUPAC name is (3R,5S)-5-methyl-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol.
| Compound Name | (3R,5S)-5-methyl-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 171774639 |
| Molecular Formula | C9H14N2OS |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | (3R,5S)-5-methyl-1-(1,3-thiazol-5-ylmethyl)pyrrolidin-3-ol |
| SMILES | C[C@H]1C[C@@H](O)CN1Cc1cncs1 |
| InChI | InChI=1S/C9H14N2OS/c1-7-2-8(12)4-11(7)5-9-3-10-6-13-9/h3,6-8,12H,2,4-5H2,1H3/t7-,8+/m0/s1 |
| InChIKey | XEMFIXHNDIFMTP-JGVFFNPUSA-N |
| XLogP | 1.10 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |