About 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine
3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine (PubChem CID 130719595) has the molecular formula C9H14N2S2
and a molecular weight of 214.36 g/mol. Its IUPAC name is 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine.
Molecular Properties
| Compound Name | 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine |
| PubChem CID | 130719595 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine |
| SMILES | CC1CSCCN1Cc1cncs1 |
| InChI | InChI=1S/C9H14N2S2/c1-8-6-12-3-2-11(8)5-9-4-10-7-13-9/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | PBLUUVXXBCPLAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine?
The IUPAC name of 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine (CID 130719595) is 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine.
What is the SMILES notation for 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine?
The canonical SMILES for 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine is CC1CSCCN1Cc1cncs1.
What is the InChIKey of 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine?
The InChIKey is PBLUUVXXBCPLAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2S2/c1-8-6-12-3-2-11(8)5-9-4-10-7-13-9/h4,7-8H,2-3,5-6H2,1H3.
What are the key properties of 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine?
3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine has a molecular weight of 214.36 g/mol, XLogP of 2.08, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine is sourced from PubChem (CID 130719595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).