C9H14N2S2 — CID 130719595
3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine (PubChem CID 130719595) has the molecular formula C9H14N2S2 and a molecular weight of 214.36 g/mol. Its IUPAC name is 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine.
| Compound Name | 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine |
|---|---|
| PubChem CID | 130719595 |
| Molecular Formula | C9H14N2S2 |
| Molecular Weight | 214.36 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-methyl-4-(1,3-thiazol-5-ylmethyl)thiomorpholine |
| SMILES | CC1CSCCN1Cc1cncs1 |
| InChI | InChI=1S/C9H14N2S2/c1-8-6-12-3-2-11(8)5-9-4-10-7-13-9/h4,7-8H,2-3,5-6H2,1H3 |
| InChIKey | PBLUUVXXBCPLAD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |