About 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride
5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride (PubChem CID 120906200) has the molecular formula C10H18ClN3S
and a molecular weight of 247.79 g/mol. Its IUPAC name is 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride.
Molecular Properties
| Compound Name | 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride |
| PubChem CID | 120906200 |
| Molecular Formula | C10H18ClN3S |
| Molecular Weight | 247.79 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride |
| SMILES | CC1CN(Cc2cncs2)C(C)CN1.Cl |
| InChI | InChI=1S/C10H17N3S.ClH/c1-8-5-13(9(2)3-12-8)6-10-4-11-7-14-10;/h4,7-9,12H,3,5-6H2,1-2H3;1H |
| InChIKey | GVZSODBKBVGSNA-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride?
The IUPAC name of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride (CID 120906200) is 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride.
What is the SMILES notation for 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride?
The canonical SMILES for 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride is CC1CN(Cc2cncs2)C(C)CN1.Cl.
What is the InChIKey of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride?
The InChIKey is GVZSODBKBVGSNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3S.ClH/c1-8-5-13(9(2)3-12-8)6-10-4-11-7-14-10;/h4,7-9,12H,3,5-6H2,1-2H3;1H.
What are the key properties of 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride?
5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride has a molecular weight of 247.79 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(2,5-dimethylpiperazin-1-yl)methyl]-1,3-thiazole;hydrochloride is sourced from PubChem (CID 120906200), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).