C9H6BrCl2NO — CID 171776552
2-bromo-N-(2,2-dichloroethenyl)benzamide (PubChem CID 171776552) has the molecular formula C9H6BrCl2NO and a molecular weight of 294.96 g/mol. Its IUPAC name is 2-bromo-N-(2,2-dichloroethenyl)benzamide.
| Compound Name | 2-bromo-N-(2,2-dichloroethenyl)benzamide |
|---|---|
| PubChem CID | 171776552 |
| Molecular Formula | C9H6BrCl2NO |
| Molecular Weight | 294.96 g/mol |
| Exact Mass | 292.90 |
| IUPAC Name | 2-bromo-N-(2,2-dichloroethenyl)benzamide |
| SMILES | O=C(NC=C(Cl)Cl)c1ccccc1Br |
| InChI | InChI=1S/C9H6BrCl2NO/c10-7-4-2-1-3-6(7)9(14)13-5-8(11)12/h1-5H,(H,13,14) |
| InChIKey | UEBUUUYDPAZVPV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.96 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |