C12H10FN3O3 — CID 171777951
4-(2-fluoro-4-methoxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide (PubChem CID 171777951) has the molecular formula C12H10FN3O3 and a molecular weight of 263.23 g/mol. Its IUPAC name is 4-(2-fluoro-4-methoxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide.
| Compound Name | 4-(2-fluoro-4-methoxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 171777951 |
| Molecular Formula | C12H10FN3O3 |
| Molecular Weight | 263.23 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 4-(2-fluoro-4-methoxyphenyl)-6-oxo-1H-pyridazine-3-carboxamide |
| SMILES | COc1ccc(-c2cc(=O)[nH]nc2C(N)=O)c(F)c1 |
| InChI | InChI=1S/C12H10FN3O3/c1-19-6-2-3-7(9(13)4-6)8-5-10(17)15-16-11(8)12(14)18/h2-5H,1H3,(H2,14,18)(H,15,17) |
| InChIKey | KNKVKFNLYHECPA-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.23 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |