C29H30N2O7S — CID 171779254
ethyl 2-[5-(benzenesulfonamido)-1,3-dioxo-6-(4-phenylbutoxy)isoindol-2-yl]propanoate (PubChem CID 171779254) has the molecular formula C29H30N2O7S and a molecular weight of 550.63 g/mol. Its IUPAC name is ethyl 2-[5-(benzenesulfonamido)-1,3-dioxo-6-(4-phenylbutoxy)isoindol-2-yl]propanoate.
| Compound Name | ethyl 2-[5-(benzenesulfonamido)-1,3-dioxo-6-(4-phenylbutoxy)isoindol-2-yl]propanoate |
|---|---|
| PubChem CID | 171779254 |
| Molecular Formula | C29H30N2O7S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | ethyl 2-[5-(benzenesulfonamido)-1,3-dioxo-6-(4-phenylbutoxy)isoindol-2-yl]propanoate |
| SMILES | CCOC(=O)C(C)N1C(=O)c2cc(NS(=O)(=O)c3ccccc3)c(OCCCCc3ccccc3)cc2C1=O |
| InChI | InChI=1S/C29H30N2O7S/c1-3-37-29(34)20(2)31-27(32)23-18-25(30-39(35,36)22-15-8-5-9-16-22)26(19-24(23)28(31)33)38-17-11-10-14-21-12-6-4-7-13-21/h4-9,12-13,15-16,18-20,30H,3,10-11,14,17H2,1-2H3 |
| InChIKey | YIUYBPOBKMXENA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|