C16H9F6N3O2 — CID 171779400
2-[4-(trifluoromethoxy)anilino]-4-(trifluoromethyl)quinazolin-6-ol (PubChem CID 171779400) has the molecular formula C16H9F6N3O2 and a molecular weight of 389.26 g/mol. Its IUPAC name is 2-[4-(trifluoromethoxy)anilino]-4-(trifluoromethyl)quinazolin-6-ol.
| Compound Name | 2-[4-(trifluoromethoxy)anilino]-4-(trifluoromethyl)quinazolin-6-ol |
|---|---|
| PubChem CID | 171779400 |
| Molecular Formula | C16H9F6N3O2 |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-[4-(trifluoromethoxy)anilino]-4-(trifluoromethyl)quinazolin-6-ol |
| SMILES | Oc1ccc2nc(Nc3ccc(OC(F)(F)F)cc3)nc(C(F)(F)F)c2c1 |
| InChI | InChI=1S/C16H9F6N3O2/c17-15(18,19)13-11-7-9(26)3-6-12(11)24-14(25-13)23-8-1-4-10(5-2-8)27-16(20,21)22/h1-7,26H,(H,23,24,25) |
| InChIKey | GCVBLAOGLQAQBY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |