C27H30N2O — CID 171784700
2-(4-methylanilino)-4,4-diphenyl-1-pyrrolidin-1-ylbutan-1-one (PubChem CID 171784700) has the molecular formula C27H30N2O and a molecular weight of 398.55 g/mol. Its IUPAC name is 2-(4-methylanilino)-4,4-diphenyl-1-pyrrolidin-1-ylbutan-1-one.
| Compound Name | 2-(4-methylanilino)-4,4-diphenyl-1-pyrrolidin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 171784700 |
| Molecular Formula | C27H30N2O |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 2-(4-methylanilino)-4,4-diphenyl-1-pyrrolidin-1-ylbutan-1-one |
| SMILES | Cc1ccc(NC(CC(c2ccccc2)c2ccccc2)C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C27H30N2O/c1-21-14-16-24(17-15-21)28-26(27(30)29-18-8-9-19-29)20-25(22-10-4-2-5-11-22)23-12-6-3-7-13-23/h2-7,10-17,25-26,28H,8-9,18-20H2,1H3 |
| InChIKey | UWRWLDAVIXEBBF-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |