C20H31NO4 — CID 171791512
(2R)-1-[(4R)-2-hydroxy-4-propan-2-yl-1,3-oxazolidin-3-yl]-2,3-dimethyl-5-phenylmethoxypentan-1-one (PubChem CID 171791512) has the molecular formula C20H31NO4 and a molecular weight of 349.47 g/mol. Its IUPAC name is (2R)-1-[(4R)-2-hydroxy-4-propan-2-yl-1,3-oxazolidin-3-yl]-2,3-dimethyl-5-phenylmethoxypentan-1-one.
| Compound Name | (2R)-1-[(4R)-2-hydroxy-4-propan-2-yl-1,3-oxazolidin-3-yl]-2,3-dimethyl-5-phenylmethoxypentan-1-one |
|---|---|
| PubChem CID | 171791512 |
| Molecular Formula | C20H31NO4 |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | (2R)-1-[(4R)-2-hydroxy-4-propan-2-yl-1,3-oxazolidin-3-yl]-2,3-dimethyl-5-phenylmethoxypentan-1-one |
| SMILES | CC(CCOCc1ccccc1)[C@@H](C)C(=O)N1C(O)OC[C@H]1C(C)C |
| InChI | InChI=1S/C20H31NO4/c1-14(2)18-13-25-20(23)21(18)19(22)16(4)15(3)10-11-24-12-17-8-6-5-7-9-17/h5-9,14-16,18,20,23H,10-13H2,1-4H3/t15?,16-,18+,20?/m1/s1 |
| InChIKey | QWAAJIDWGKGFRA-WXNRQPJFSA-N |
| XLogP | 3.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|