C16H19BrF3N3O — CID 171794451
(2Z,4E)-N-[1-(6-bromo-3-pyridinyl)ethyl]-2-(dimethylamino)-4-(trifluoromethyl)hexa-2,4-dienamide (PubChem CID 171794451) has the molecular formula C16H19BrF3N3O and a molecular weight of 406.25 g/mol. Its IUPAC name is (2Z,4E)-N-[1-(6-bromo-3-pyridinyl)ethyl]-2-(dimethylamino)-4-(trifluoromethyl)hexa-2,4-dienamide.
| Compound Name | (2Z,4E)-N-[1-(6-bromo-3-pyridinyl)ethyl]-2-(dimethylamino)-4-(trifluoromethyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 171794451 |
| Molecular Formula | C16H19BrF3N3O |
| Molecular Weight | 406.25 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (2Z,4E)-N-[1-(6-bromo-3-pyridinyl)ethyl]-2-(dimethylamino)-4-(trifluoromethyl)hexa-2,4-dienamide |
| SMILES | C/C=C(\C=C(\C(=O)NC(C)c1ccc(Br)nc1)N(C)C)C(F)(F)F |
| InChI | InChI=1S/C16H19BrF3N3O/c1-5-12(16(18,19)20)8-13(23(3)4)15(24)22-10(2)11-6-7-14(17)21-9-11/h5-10H,1-4H3,(H,22,24)/b12-5+,13-8- |
| InChIKey | AXMMHPSKNFUULH-OVVRZAFYSA-N |
| XLogP | 3.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.25 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|