C17H18N6 — CID 171795758
N-(4-piperazin-1-yl-2-pyridinyl)-1,6-naphthyridin-2-amine (PubChem CID 171795758) has the molecular formula C17H18N6 and a molecular weight of 306.37 g/mol. Its IUPAC name is N-(4-piperazin-1-yl-2-pyridinyl)-1,6-naphthyridin-2-amine.
| Compound Name | N-(4-piperazin-1-yl-2-pyridinyl)-1,6-naphthyridin-2-amine |
|---|---|
| PubChem CID | 171795758 |
| Molecular Formula | C17H18N6 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | N-(4-piperazin-1-yl-2-pyridinyl)-1,6-naphthyridin-2-amine |
| SMILES | c1cc2nc(Nc3cc(N4CCNCC4)ccn3)ccc2cn1 |
| InChI | InChI=1S/C17H18N6/c1-2-16(21-15-4-5-19-12-13(1)15)22-17-11-14(3-6-20-17)23-9-7-18-8-10-23/h1-6,11-12,18H,7-10H2,(H,20,21,22) |
| InChIKey | XHJLMYAFQMWNEK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |