C25H29N7 — CID 58299638
8-cyclohexyl-N-(5-piperazin-1-yl-2-pyridinyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine (PubChem CID 58299638) has the molecular formula C25H29N7 and a molecular weight of 427.56 g/mol. Its IUPAC name is 8-cyclohexyl-N-(5-piperazin-1-yl-2-pyridinyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine.
| Compound Name | 8-cyclohexyl-N-(5-piperazin-1-yl-2-pyridinyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
|---|---|
| PubChem CID | 58299638 |
| Molecular Formula | C25H29N7 |
| Molecular Weight | 427.56 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 8-cyclohexyl-N-(5-piperazin-1-yl-2-pyridinyl)-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-5-amine |
| SMILES | c1cc2c3cnc(Nc4ccc(N5CCNCC5)cn4)cc3n(C3CCCCC3)c2cn1 |
| InChI | InChI=1S/C25H29N7/c1-2-4-18(5-3-1)32-22-14-25(29-16-21(22)20-8-9-27-17-23(20)32)30-24-7-6-19(15-28-24)31-12-10-26-11-13-31/h6-9,14-18,26H,1-5,10-13H2,(H,28,29,30) |
| InChIKey | JNWDMRNNBZSXQY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.56 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |