C26H25N7S — CID 90982493
3-[[5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]methyl]benzenethiol (PubChem CID 90982493) has the molecular formula C26H25N7S and a molecular weight of 467.60 g/mol. Its IUPAC name is 3-[[5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]methyl]benzenethiol.
| Compound Name | 3-[[5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]methyl]benzenethiol |
|---|---|
| PubChem CID | 90982493 |
| Molecular Formula | C26H25N7S |
| Molecular Weight | 467.60 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-[[5-[(5-piperazin-1-yl-2-pyridinyl)amino]-4,8,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaen-8-yl]methyl]benzenethiol |
| SMILES | Sc1cccc(Cn2c3cnccc3c3cnc(Nc4ccc(N5CCNCC5)cn4)cc32)c1 |
| InChI | InChI=1S/C26H25N7S/c34-20-3-1-2-18(12-20)17-33-23-13-26(30-15-22(23)21-6-7-28-16-24(21)33)31-25-5-4-19(14-29-25)32-10-8-27-9-11-32/h1-7,12-16,27,34H,8-11,17H2,(H,29,30,31) |
| InChIKey | BMAWQMWYKGXYNP-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.60 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|