C19H22N6 — CID 177366069
4-(1,4-diazepan-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-2-amine (PubChem CID 177366069) has the molecular formula C19H22N6 and a molecular weight of 334.43 g/mol. Its IUPAC name is 4-(1,4-diazepan-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-2-amine.
| Compound Name | 4-(1,4-diazepan-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 177366069 |
| Molecular Formula | C19H22N6 |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 4-(1,4-diazepan-1-yl)-N-(quinoxalin-6-ylmethyl)pyridin-2-amine |
| SMILES | c1cc(N2CCCNCC2)cc(NCc2ccc3nccnc3c2)n1 |
| InChI | InChI=1S/C19H22N6/c1-5-20-9-11-25(10-1)16-4-6-23-19(13-16)24-14-15-2-3-17-18(12-15)22-8-7-21-17/h2-4,6-8,12-13,20H,1,5,9-11,14H2,(H,23,24) |
| InChIKey | VWQKQFSXHHLLOE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 65.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |