C22H18F2N2O2S — CID 171797086
1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[4-(methylaminosulfanyl)phenyl]indol-2-one (PubChem CID 171797086) has the molecular formula C22H18F2N2O2S and a molecular weight of 412.46 g/mol. Its IUPAC name is 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[4-(methylaminosulfanyl)phenyl]indol-2-one.
| Compound Name | 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[4-(methylaminosulfanyl)phenyl]indol-2-one |
|---|---|
| PubChem CID | 171797086 |
| Molecular Formula | C22H18F2N2O2S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-[(3,4-difluorophenyl)methyl]-3-hydroxy-3-[4-(methylaminosulfanyl)phenyl]indol-2-one |
| SMILES | CNSc1ccc(C2(O)C(=O)N(Cc3ccc(F)c(F)c3)c3ccccc32)cc1 |
| InChI | InChI=1S/C22H18F2N2O2S/c1-25-29-16-9-7-15(8-10-16)22(28)17-4-2-3-5-20(17)26(21(22)27)13-14-6-11-18(23)19(24)12-14/h2-12,25,28H,13H2,1H3 |
| InChIKey | GBHMODFDYVLVRJ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|