C24H19FN2O3 — CID 71729331
1-benzyl-6-fluoro-3-hydroxy-3-(1-methyl-2-oxo-3H-indol-3-yl)indol-2-one (PubChem CID 71729331) has the molecular formula C24H19FN2O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is 1-benzyl-6-fluoro-3-hydroxy-3-(1-methyl-2-oxo-3H-indol-3-yl)indol-2-one.
| Compound Name | 1-benzyl-6-fluoro-3-hydroxy-3-(1-methyl-2-oxo-3H-indol-3-yl)indol-2-one |
|---|---|
| PubChem CID | 71729331 |
| Molecular Formula | C24H19FN2O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 1-benzyl-6-fluoro-3-hydroxy-3-(1-methyl-2-oxo-3H-indol-3-yl)indol-2-one |
| SMILES | CN1C(=O)C(C2(O)C(=O)N(Cc3ccccc3)c3cc(F)ccc32)c2ccccc21 |
| InChI | InChI=1S/C24H19FN2O3/c1-26-19-10-6-5-9-17(19)21(22(26)28)24(30)18-12-11-16(25)13-20(18)27(23(24)29)14-15-7-3-2-4-8-15/h2-13,21,30H,14H2,1H3 |
| InChIKey | MYFZWVCQIUOCKS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |