C16H11F2NO3 — CID 171802044
4-[(4-cyanophenyl)methoxy]-2,3-difluoro-5-methylbenzoic acid (PubChem CID 171802044) has the molecular formula C16H11F2NO3 and a molecular weight of 303.26 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)methoxy]-2,3-difluoro-5-methylbenzoic acid.
| Compound Name | 4-[(4-cyanophenyl)methoxy]-2,3-difluoro-5-methylbenzoic acid |
|---|---|
| PubChem CID | 171802044 |
| Molecular Formula | C16H11F2NO3 |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 4-[(4-cyanophenyl)methoxy]-2,3-difluoro-5-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)c(F)c(F)c1OCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H11F2NO3/c1-9-6-12(16(20)21)13(17)14(18)15(9)22-8-11-4-2-10(7-19)3-5-11/h2-6H,8H2,1H3,(H,20,21) |
| InChIKey | JWRWYSGFIXUXQL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |