C22H36O2 — CID 171802070
5,6-dimethylhept-6-en-2-one;ethane;1-(2-ethyl-3-methylphenyl)ethanone (PubChem CID 171802070) has the molecular formula C22H36O2 and a molecular weight of 332.53 g/mol. Its IUPAC name is 5,6-dimethylhept-6-en-2-one;ethane;1-(2-ethyl-3-methylphenyl)ethanone.
| Compound Name | 5,6-dimethylhept-6-en-2-one;ethane;1-(2-ethyl-3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 171802070 |
| Molecular Formula | C22H36O2 |
| Molecular Weight | 332.53 g/mol |
| Exact Mass | 332.27 |
| IUPAC Name | 5,6-dimethylhept-6-en-2-one;ethane;1-(2-ethyl-3-methylphenyl)ethanone |
| SMILES | C=C(C)C(C)CCC(C)=O.CC.CCc1c(C)cccc1C(C)=O |
| InChI | InChI=1S/C11H14O.C9H16O.C2H6/c1-4-10-8(2)6-5-7-11(10)9(3)12;1-7(2)8(3)5-6-9(4)10;1-2/h5-7H,4H2,1-3H3;8H,1,5-6H2,2-4H3;1-2H3 |
| InChIKey | IBTQQAUFKMACQE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.53 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|