C20H16ClF3N6O — CID 171805451
7-[[4-chloro-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 171805451) has the molecular formula C20H16ClF3N6O and a molecular weight of 448.84 g/mol. Its IUPAC name is 7-[[4-chloro-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[[4-chloro-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171805451 |
| Molecular Formula | C20H16ClF3N6O |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 7-[[4-chloro-5-(2,2,2-trifluoroethyl)pyrimido[5,4-b]indol-8-yl]methyl]-3,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1CCN(Cc1ccc3c(c1)c1ncnc(Cl)c1n3CC(F)(F)F)C2 |
| InChI | InChI=1S/C20H16ClF3N6O/c21-18-17-16(26-10-27-18)13-5-11(1-2-15(13)30(17)8-20(22,23)24)6-29-4-3-12-14(7-29)25-9-28-19(12)31/h1-2,5,9-10H,3-4,6-8H2,(H,25,28,31) |
| InChIKey | VGSSEPFGYRYACT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |