C18H15F3N4O2 — CID 171807026
7-tert-butyl-2-prop-2-ynoxy-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one (PubChem CID 171807026) has the molecular formula C18H15F3N4O2 and a molecular weight of 376.34 g/mol. Its IUPAC name is 7-tert-butyl-2-prop-2-ynoxy-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one.
| Compound Name | 7-tert-butyl-2-prop-2-ynoxy-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
|---|---|
| PubChem CID | 171807026 |
| Molecular Formula | C18H15F3N4O2 |
| Molecular Weight | 376.34 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 7-tert-butyl-2-prop-2-ynoxy-8-(3,4,5-trifluorophenyl)-3H-pyrazolo[1,5-a][1,3,5]triazin-4-one |
| SMILES | C#CCOc1nc2c(-c3cc(F)c(F)c(F)c3)c(C(C)(C)C)nn2c(=O)[nH]1 |
| InChI | InChI=1S/C18H15F3N4O2/c1-5-6-27-16-22-15-12(9-7-10(19)13(21)11(20)8-9)14(18(2,3)4)24-25(15)17(26)23-16/h1,7-8H,6H2,2-4H3,(H,22,23,26) |
| InChIKey | PUMPDAIZRVSTSV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|