C16H14BF4N4O3P — CID 171806789
CID 171806789 (PubChem CID 171806789) has the molecular formula C16H14BF4N4O3P and a molecular weight of 428.09 g/mol.
| Compound Name | CID 171806789 |
|---|---|
| PubChem CID | 171806789 |
| Molecular Formula | C16H14BF4N4O3P |
| Molecular Weight | 428.09 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | — |
| SMILES | [B]OC(C)c1nn2c(=O)[nH]c(OCC(F)(F)F)nc2c1-c1cc(C)c(P)c(F)c1 |
| InChI | InChI=1S/C16H14BF4N4O3P/c1-6-3-8(4-9(18)12(6)29)10-11(7(2)28-17)24-25-13(10)22-14(23-15(25)26)27-5-16(19,20)21/h3-4,7H,5,29H2,1-2H3,(H,22,23,26) |
| InChIKey | NGXZVOQEDBBDPF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.09 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|