C15H14FN5O — CID 171807254
5-fluoro-2-[[[3-(1-methyltriazol-4-yl)-2-pyridinyl]amino]methyl]phenol (PubChem CID 171807254) has the molecular formula C15H14FN5O and a molecular weight of 299.31 g/mol. Its IUPAC name is 5-fluoro-2-[[[3-(1-methyltriazol-4-yl)-2-pyridinyl]amino]methyl]phenol.
| Compound Name | 5-fluoro-2-[[[3-(1-methyltriazol-4-yl)-2-pyridinyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 171807254 |
| Molecular Formula | C15H14FN5O |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 5-fluoro-2-[[[3-(1-methyltriazol-4-yl)-2-pyridinyl]amino]methyl]phenol |
| SMILES | Cn1cc(-c2cccnc2NCc2ccc(F)cc2O)nn1 |
| InChI | InChI=1S/C15H14FN5O/c1-21-9-13(19-20-21)12-3-2-6-17-15(12)18-8-10-4-5-11(16)7-14(10)22/h2-7,9,22H,8H2,1H3,(H,17,18) |
| InChIKey | XGRSGGJSYVXALX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|