C28H30BN3O6 — CID 171809403
3-[3-oxo-7-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]but-1-ynyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 171809403) has the molecular formula C28H30BN3O6 and a molecular weight of 515.38 g/mol. Its IUPAC name is 3-[3-oxo-7-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]but-1-ynyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-7-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]but-1-ynyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 171809403 |
| Molecular Formula | C28H30BN3O6 |
| Molecular Weight | 515.38 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | 3-[3-oxo-7-[4-[[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-pyridinyl]oxy]but-1-ynyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | CC1(C)OB(c2ccc(OCCC#Cc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)nc2)OC1(C)C |
| InChI | InChI=1S/C28H30BN3O6/c1-27(2)28(3,4)38-29(37-27)19-11-14-24(30-16-19)36-15-6-5-8-18-9-7-10-20-21(18)17-32(26(20)35)22-12-13-23(33)31-25(22)34/h7,9-11,14,16,22H,6,12-13,15,17H2,1-4H3,(H,31,33,34) |
| InChIKey | UEIAWZHQKCBZCY-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.38 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|