C30H31BN2O7 — CID 171809139
4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate (PubChem CID 171809139) has the molecular formula C30H31BN2O7 and a molecular weight of 542.40 g/mol. Its IUPAC name is 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.
| Compound Name | 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
|---|---|
| PubChem CID | 171809139 |
| Molecular Formula | C30H31BN2O7 |
| Molecular Weight | 542.40 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | 4-[2-(2,6-dioxopiperidin-3-yl)-1-oxo-3H-isoindol-4-yl]but-3-ynyl 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate |
| SMILES | CC1(C)OB(c2ccc(C(=O)OCCC#Cc3cccc4c3CN(C3CCC(=O)NC3=O)C4=O)cc2)OC1(C)C |
| InChI | InChI=1S/C30H31BN2O7/c1-29(2)30(3,4)40-31(39-29)21-13-11-20(12-14-21)28(37)38-17-6-5-8-19-9-7-10-22-23(19)18-33(27(22)36)24-15-16-25(34)32-26(24)35/h7,9-14,24H,6,15-18H2,1-4H3,(H,32,34,35) |
| InChIKey | NKDWCORKWNTURP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|