C19H32FN3O2 — CID 171811097
(2Z,4Z)-1-[4-(2-fluorobutanoyl)piperazin-1-yl]-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-one;propane (PubChem CID 171811097) has the molecular formula C19H32FN3O2 and a molecular weight of 353.48 g/mol. Its IUPAC name is (2Z,4Z)-1-[4-(2-fluorobutanoyl)piperazin-1-yl]-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-one;propane.
| Compound Name | (2Z,4Z)-1-[4-(2-fluorobutanoyl)piperazin-1-yl]-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-one;propane |
|---|---|
| PubChem CID | 171811097 |
| Molecular Formula | C19H32FN3O2 |
| Molecular Weight | 353.48 g/mol |
| Exact Mass | 353.25 |
| IUPAC Name | (2Z,4Z)-1-[4-(2-fluorobutanoyl)piperazin-1-yl]-4-methyl-2-(methylideneamino)hexa-2,4-dien-1-one;propane |
| SMILES | C=N/C(=C\C(C)=C/C)C(=O)N1CCN(C(=O)C(F)CC)CC1.CCC |
| InChI | InChI=1S/C16H24FN3O2.C3H8/c1-5-12(3)11-14(18-4)16(22)20-9-7-19(8-10-20)15(21)13(17)6-2;1-3-2/h5,11,13H,4,6-10H2,1-3H3;3H2,1-2H3/b12-5-,14-11-; |
| InChIKey | PUBLXABYWIRZNK-MSUDWUBSSA-N |
| XLogP | 3.37 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.48 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|