About 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one
1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one (PubChem CID 171811296) has the molecular formula C18H27ClO2
and a molecular weight of 310.87 g/mol. Its IUPAC name is 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one.
Molecular Properties
| Compound Name | 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one |
| PubChem CID | 171811296 |
| Molecular Formula | C18H27ClO2 |
| Molecular Weight | 310.87 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one |
| SMILES | CC1CCC(=O)CC1.CCCOc1c(Cl)cccc1CC |
| InChI | InChI=1S/C11H15ClO.C7H12O/c1-3-8-13-11-9(4-2)6-5-7-10(11)12;1-6-2-4-7(8)5-3-6/h5-7H,3-4,8H2,1-2H3;6H,2-5H2,1H3 |
| InChIKey | ZJTDCDHPPOHSKX-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.87 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one?
The IUPAC name of 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one (CID 171811296) is 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one.
What is the SMILES notation for 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one?
The canonical SMILES for 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one is CC1CCC(=O)CC1.CCCOc1c(Cl)cccc1CC.
What is the InChIKey of 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one?
The InChIKey is ZJTDCDHPPOHSKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClO.C7H12O/c1-3-8-13-11-9(4-2)6-5-7-10(11)12;1-6-2-4-7(8)5-3-6/h5-7H,3-4,8H2,1-2H3;6H,2-5H2,1H3.
What are the key properties of 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one?
1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one has a molecular weight of 310.87 g/mol, XLogP of 5.46, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-ethyl-2-propoxybenzene;4-methylcyclohexan-1-one is sourced from PubChem (CID 171811296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).