C15H27N3 — CID 171811413
(2E,5E)-1,4-diimino-5-methyl-N,N-dipropylocta-2,5-dien-2-amine (PubChem CID 171811413) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (2E,5E)-1,4-diimino-5-methyl-N,N-dipropylocta-2,5-dien-2-amine.
| Compound Name | (2E,5E)-1,4-diimino-5-methyl-N,N-dipropylocta-2,5-dien-2-amine |
|---|---|
| PubChem CID | 171811413 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (2E,5E)-1,4-diimino-5-methyl-N,N-dipropylocta-2,5-dien-2-amine |
| SMILES | [H]/N=C(/C=C(\C=N\[H])N(CCC)CCC)C(\C)=C\CC |
| InChI | InChI=1S/C15H27N3/c1-5-8-13(4)15(17)11-14(12-16)18(9-6-2)10-7-3/h8,11-12,16-17H,5-7,9-10H2,1-4H3/b13-8+,14-11+,16-12+,17-15- |
| InChIKey | FJUMEVUWSCJBRL-BFIZFFGXSA-N |
| XLogP | 4.02 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|