C10H20N2 — CID 123719806
(E)-1-imino-N,4-dimethyl-N-propylpent-2-en-3-amine (PubChem CID 123719806) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is (E)-1-imino-N,4-dimethyl-N-propylpent-2-en-3-amine.
| Compound Name | (E)-1-imino-N,4-dimethyl-N-propylpent-2-en-3-amine |
|---|---|
| PubChem CID | 123719806 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | (E)-1-imino-N,4-dimethyl-N-propylpent-2-en-3-amine |
| SMILES | [H]/N=C/C=C(\C(C)C)N(C)CCC |
| InChI | InChI=1S/C10H20N2/c1-5-8-12(4)10(6-7-11)9(2)3/h6-7,9,11H,5,8H2,1-4H3/b10-6+,11-7+ |
| InChIKey | CDGSPIWSXKGNFD-JMQWPVDRSA-N |
| XLogP | 2.52 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|