C13H23N2+ — CID 91465705
3,4-dimethylpent-2-enylidene-methyl-(4-methyliminobut-2-en-2-yl)azanium (PubChem CID 91465705) has the molecular formula C13H23N2+ and a molecular weight of 207.34 g/mol. Its IUPAC name is 3,4-dimethylpent-2-enylidene-methyl-(4-methyliminobut-2-en-2-yl)azanium.
| Compound Name | 3,4-dimethylpent-2-enylidene-methyl-(4-methyliminobut-2-en-2-yl)azanium |
|---|---|
| PubChem CID | 91465705 |
| Molecular Formula | C13H23N2+ |
| Molecular Weight | 207.34 g/mol |
| Exact Mass | 207.19 |
| IUPAC Name | 3,4-dimethylpent-2-enylidene-methyl-(4-methyliminobut-2-en-2-yl)azanium |
| SMILES | C/N=C/C=C(C)/[N+](C)=C/C=C(C)C(C)C |
| InChI | InChI=1S/C13H23N2/c1-11(2)12(3)8-10-15(6)13(4)7-9-14-5/h7-11H,1-6H3/q+1/b12-8?,13-7?,14-9+,15-10+ |
| InChIKey | CFSHXLQFDULCMT-ONFQJRMHSA-N |
| XLogP | 2.91 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|