C15H8BrF7O2 — CID 171814223
4-bromo-2-(1,1,2,2-tetrafluoroethyl)-1-[4-(trifluoromethoxy)phenoxy]benzene (PubChem CID 171814223) has the molecular formula C15H8BrF7O2 and a molecular weight of 433.12 g/mol. Its IUPAC name is 4-bromo-2-(1,1,2,2-tetrafluoroethyl)-1-[4-(trifluoromethoxy)phenoxy]benzene.
| Compound Name | 4-bromo-2-(1,1,2,2-tetrafluoroethyl)-1-[4-(trifluoromethoxy)phenoxy]benzene |
|---|---|
| PubChem CID | 171814223 |
| Molecular Formula | C15H8BrF7O2 |
| Molecular Weight | 433.12 g/mol |
| Exact Mass | 431.96 |
| IUPAC Name | 4-bromo-2-(1,1,2,2-tetrafluoroethyl)-1-[4-(trifluoromethoxy)phenoxy]benzene |
| SMILES | FC(F)C(F)(F)c1cc(Br)ccc1Oc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H8BrF7O2/c16-8-1-6-12(11(7-8)14(19,20)13(17)18)24-9-2-4-10(5-3-9)25-15(21,22)23/h1-7,13H |
| InChIKey | IDLSAKCSWYPJBA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.12 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|