C25H32N6O4 — CID 171816588
(2R,3R,4S,5R)-2-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol (PubChem CID 171816588) has the molecular formula C25H32N6O4 and a molecular weight of 480.57 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 171816588 |
| Molecular Formula | C25H32N6O4 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (2R,3R,4S,5R)-2-[6-(3,4-dihydro-1H-isoquinolin-2-yl)-8-[(4-hydroxycyclohexyl)amino]purin-9-yl]-5-methyloxolane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](n2c(NC3CCC(O)CC3)nc3c(N4CCc5ccccc5C4)ncnc32)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C25H32N6O4/c1-14-20(33)21(34)24(35-14)31-23-19(29-25(31)28-17-6-8-18(32)9-7-17)22(26-13-27-23)30-11-10-15-4-2-3-5-16(15)12-30/h2-5,13-14,17-18,20-21,24,32-34H,6-12H2,1H3,(H,28,29)/t14-,17?,18?,20-,21-,24-/m1/s1 |
| InChIKey | FXDONUUKSJXJPI-ODMKNCKRSA-N |
| XLogP | 1.74 |
| TPSA | 128.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |