C29H40N8O10 — CID 171818350
tert-butyl N-[2-[[[4-[[(2S)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]propanoyl]amino]phenyl]methoxycarbonylamino]carbamoylamino]ethyl]carbamate (PubChem CID 171818350) has the molecular formula C29H40N8O10 and a molecular weight of 660.69 g/mol. Its IUPAC name is tert-butyl N-[2-[[[4-[[(2S)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]propanoyl]amino]phenyl]methoxycarbonylamino]carbamoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[[4-[[(2S)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]propanoyl]amino]phenyl]methoxycarbonylamino]carbamoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 171818350 |
| Molecular Formula | C29H40N8O10 |
| Molecular Weight | 660.69 g/mol |
| Exact Mass | 660.29 |
| IUPAC Name | tert-butyl N-[2-[[[4-[[(2S)-2-[[(2S)-2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]propanoyl]amino]propanoyl]amino]phenyl]methoxycarbonylamino]carbamoylamino]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)CCN1C(=O)C=CC1=O)C(=O)N[C@@H](C)C(=O)Nc1ccc(COC(=O)NNC(=O)NCCNC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H40N8O10/c1-17(32-21(38)12-15-37-22(39)10-11-23(37)40)24(41)33-18(2)25(42)34-20-8-6-19(7-9-20)16-46-28(45)36-35-26(43)30-13-14-31-27(44)47-29(3,4)5/h6-11,17-18H,12-16H2,1-5H3,(H,31,44)(H,32,38)(H,33,41)(H,34,42)(H,36,45)(H2,30,35,43)/t17-,18-/m0/s1 |
| InChIKey | ZYQJFWHKWZWILG-ROUUACIJSA-N |
| XLogP | -0.09 |
| TPSA | 242.47 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.69 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|