C19H23NO2 — CID 171819016
(3S,4S)-N,N-dibenzyl-4-methoxyoxolan-3-amine (PubChem CID 171819016) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is (3S,4S)-N,N-dibenzyl-4-methoxyoxolan-3-amine.
| Compound Name | (3S,4S)-N,N-dibenzyl-4-methoxyoxolan-3-amine |
|---|---|
| PubChem CID | 171819016 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | (3S,4S)-N,N-dibenzyl-4-methoxyoxolan-3-amine |
| SMILES | CO[C@@H]1COC[C@@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23NO2/c1-21-19-15-22-14-18(19)20(12-16-8-4-2-5-9-16)13-17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3/t18-,19+/m0/s1 |
| InChIKey | WKOFFTLRXCJYJP-RBUKOAKNSA-N |
| XLogP | 3.10 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |