C16H22N4 — CID 171819508
2-N-(4-methylpentan-2-yl)-5-N-phenylpyrazine-2,5-diamine (PubChem CID 171819508) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is 2-N-(4-methylpentan-2-yl)-5-N-phenylpyrazine-2,5-diamine.
| Compound Name | 2-N-(4-methylpentan-2-yl)-5-N-phenylpyrazine-2,5-diamine |
|---|---|
| PubChem CID | 171819508 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2-N-(4-methylpentan-2-yl)-5-N-phenylpyrazine-2,5-diamine |
| SMILES | CC(C)CC(C)Nc1cnc(Nc2ccccc2)cn1 |
| InChI | InChI=1S/C16H22N4/c1-12(2)9-13(3)19-15-10-18-16(11-17-15)20-14-7-5-4-6-8-14/h4-8,10-13H,9H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | NMNBHSBUBUDFIG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |