C16H23N5 — CID 171819736
3-N-(5-methylhexan-2-yl)-6-N-phenyl-1,2,4-triazine-3,6-diamine (PubChem CID 171819736) has the molecular formula C16H23N5 and a molecular weight of 285.39 g/mol. Its IUPAC name is 3-N-(5-methylhexan-2-yl)-6-N-phenyl-1,2,4-triazine-3,6-diamine.
| Compound Name | 3-N-(5-methylhexan-2-yl)-6-N-phenyl-1,2,4-triazine-3,6-diamine |
|---|---|
| PubChem CID | 171819736 |
| Molecular Formula | C16H23N5 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 3-N-(5-methylhexan-2-yl)-6-N-phenyl-1,2,4-triazine-3,6-diamine |
| SMILES | CC(C)CCC(C)Nc1ncc(Nc2ccccc2)nn1 |
| InChI | InChI=1S/C16H23N5/c1-12(2)9-10-13(3)18-16-17-11-15(20-21-16)19-14-7-5-4-6-8-14/h4-8,11-13H,9-10H2,1-3H3,(H,19,20)(H,17,18,21) |
| InChIKey | WKDUGSAQYXYJIL-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_6_tetrazine(18)', 'substructure': 'N/A'} |
|---|