C36H50N8 — CID 175506207
6-N-(4-anilinophenyl)-4-N-[4-(5-methylhexan-2-ylamino)phenyl]-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 175506207) has the molecular formula C36H50N8 and a molecular weight of 594.85 g/mol. Its IUPAC name is 6-N-(4-anilinophenyl)-4-N-[4-(5-methylhexan-2-ylamino)phenyl]-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(4-anilinophenyl)-4-N-[4-(5-methylhexan-2-ylamino)phenyl]-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 175506207 |
| Molecular Formula | C36H50N8 |
| Molecular Weight | 594.85 g/mol |
| Exact Mass | 594.42 |
| IUPAC Name | 6-N-(4-anilinophenyl)-4-N-[4-(5-methylhexan-2-ylamino)phenyl]-2-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | CC(C)CCC(C)Nc1ccc(Nc2nc(Nc3ccc(Nc4ccccc4)cc3)nc(NC(C)(C)CC(C)(C)C)n2)cc1 |
| InChI | InChI=1S/C36H50N8/c1-25(2)14-15-26(3)37-28-16-20-30(21-17-28)39-32-41-33(43-34(42-32)44-36(7,8)24-35(4,5)6)40-31-22-18-29(19-23-31)38-27-12-10-9-11-13-27/h9-13,16-23,25-26,37-38H,14-15,24H2,1-8H3,(H3,39,40,41,42,43,44) |
| InChIKey | KSAXZUUMUNHTBX-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.85 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |