C37H50N4 — CID 22119349
4-N-(5-methylhexan-2-yl)-1-N-phenylbenzene-1,4-diamine;4-N-(2-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine (PubChem CID 22119349) has the molecular formula C37H50N4 and a molecular weight of 550.84 g/mol. Its IUPAC name is 4-N-(5-methylhexan-2-yl)-1-N-phenylbenzene-1,4-diamine;4-N-(2-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine.
| Compound Name | 4-N-(5-methylhexan-2-yl)-1-N-phenylbenzene-1,4-diamine;4-N-(2-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 22119349 |
| Molecular Formula | C37H50N4 |
| Molecular Weight | 550.84 g/mol |
| Exact Mass | 550.40 |
| IUPAC Name | 4-N-(5-methylhexan-2-yl)-1-N-phenylbenzene-1,4-diamine;4-N-(2-methylpentan-2-yl)-1-N-phenylbenzene-1,4-diamine |
| SMILES | CC(C)CCC(C)Nc1ccc(Nc2ccccc2)cc1.CCCC(C)(C)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H26N2.C18H24N2/c1-15(2)9-10-16(3)20-18-11-13-19(14-12-18)21-17-7-5-4-6-8-17;1-4-14-18(2,3)20-17-12-10-16(11-13-17)19-15-8-6-5-7-9-15/h4-8,11-16,20-21H,9-10H2,1-3H3;5-13,19-20H,4,14H2,1-3H3 |
| InChIKey | USENZABUOOJTIH-UHFFFAOYSA-N |
| XLogP | 11.09 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.84 |
| LogP ≤ 5 | 11.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|