C17H20N6O3 — CID 171820136
5-amino-4-(3-hydroxy-2-methylphenyl)-1,3-dimethylpyrazolo[3,4-b]pyridine-6-carboxamide;formamide (PubChem CID 171820136) has the molecular formula C17H20N6O3 and a molecular weight of 356.39 g/mol. Its IUPAC name is 5-amino-4-(3-hydroxy-2-methylphenyl)-1,3-dimethylpyrazolo[3,4-b]pyridine-6-carboxamide;formamide.
| Compound Name | 5-amino-4-(3-hydroxy-2-methylphenyl)-1,3-dimethylpyrazolo[3,4-b]pyridine-6-carboxamide;formamide |
|---|---|
| PubChem CID | 171820136 |
| Molecular Formula | C17H20N6O3 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 5-amino-4-(3-hydroxy-2-methylphenyl)-1,3-dimethylpyrazolo[3,4-b]pyridine-6-carboxamide;formamide |
| SMILES | Cc1c(O)cccc1-c1c(N)c(C(N)=O)nc2c1c(C)nn2C.NC=O |
| InChI | InChI=1S/C16H17N5O2.CH3NO/c1-7-9(5-4-6-10(7)22)12-11-8(2)20-21(3)16(11)19-14(13(12)17)15(18)23;2-1-3/h4-6,22H,17H2,1-3H3,(H2,18,23);1H,(H2,2,3) |
| InChIKey | LYHDRVFYFRXNHK-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 163.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|