C14H24N2 — CID 171820763
ethane;1,3,7-trimethylindazole (PubChem CID 171820763) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is ethane;1,3,7-trimethylindazole.
| Compound Name | ethane;1,3,7-trimethylindazole |
|---|---|
| PubChem CID | 171820763 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | ethane;1,3,7-trimethylindazole |
| SMILES | CC.CC.Cc1nn(C)c2c(C)cccc12 |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-7-5-4-6-9-8(2)11-12(3)10(7)9;2*1-2/h4-6H,1-3H3;2*1-2H3 |
| InChIKey | ARTOPNHGNAUQPL-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |