C8H9N3O — CID 178124637
1,3-dimethyl-7-oxidopyrazolo[5,4-b]pyridin-7-ium (PubChem CID 178124637) has the molecular formula C8H9N3O and a molecular weight of 163.18 g/mol. Its IUPAC name is 1,3-dimethyl-7-oxidopyrazolo[5,4-b]pyridin-7-ium.
| Compound Name | 1,3-dimethyl-7-oxidopyrazolo[5,4-b]pyridin-7-ium |
|---|---|
| PubChem CID | 178124637 |
| Molecular Formula | C8H9N3O |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.07 |
| IUPAC Name | 1,3-dimethyl-7-oxidopyrazolo[5,4-b]pyridin-7-ium |
| SMILES | Cc1nn(C)c2c1ccc[n+]2[O-] |
| InChI | InChI=1S/C8H9N3O/c1-6-7-4-3-5-11(12)8(7)10(2)9-6/h3-5H,1-2H3 |
| InChIKey | UHPJRNMUMABQRX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|