C13H23N3 — CID 177008769
ethane;1,3,6-trimethylpyrazolo[5,4-b]pyridine (PubChem CID 177008769) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is ethane;1,3,6-trimethylpyrazolo[5,4-b]pyridine.
| Compound Name | ethane;1,3,6-trimethylpyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 177008769 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | ethane;1,3,6-trimethylpyrazolo[5,4-b]pyridine |
| SMILES | CC.CC.Cc1ccc2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C9H11N3.2C2H6/c1-6-4-5-8-7(2)11-12(3)9(8)10-6;2*1-2/h4-5H,1-3H3;2*1-2H3 |
| InChIKey | PQPNCECUTUNSRQ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |