C8H11N5 — CID 55282105
(1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)hydrazine (PubChem CID 55282105) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is (1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)hydrazine.
| Compound Name | (1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)hydrazine |
|---|---|
| PubChem CID | 55282105 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | (1,3-dimethylpyrazolo[5,4-b]pyridin-6-yl)hydrazine |
| SMILES | Cc1nn(C)c2nc(NN)ccc12 |
| InChI | InChI=1S/C8H11N5/c1-5-6-3-4-7(11-9)10-8(6)13(2)12-5/h3-4H,9H2,1-2H3,(H,10,11) |
| InChIKey | FLRAKPQPEHTDBU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|