C11H17N5 — CID 70652053
(1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)hydrazine (PubChem CID 70652053) has the molecular formula C11H17N5 and a molecular weight of 219.29 g/mol. Its IUPAC name is (1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)hydrazine.
| Compound Name | (1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)hydrazine |
|---|---|
| PubChem CID | 70652053 |
| Molecular Formula | C11H17N5 |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | (1,3-dimethyl-4-propan-2-ylpyrazolo[5,4-b]pyridin-6-yl)hydrazine |
| SMILES | Cc1nn(C)c2nc(NN)cc(C(C)C)c12 |
| InChI | InChI=1S/C11H17N5/c1-6(2)8-5-9(14-12)13-11-10(8)7(3)15-16(11)4/h5-6H,12H2,1-4H3,(H,13,14) |
| InChIKey | VNFPJCIMEBFXTM-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|