About 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine
1,3,6-trimethylpyrazolo[3,4-d]pyrimidine (PubChem CID 58861824) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine |
| PubChem CID | 58861824 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine |
| SMILES | Cc1ncc2c(C)nn(C)c2n1 |
| InChI | InChI=1S/C8H10N4/c1-5-7-4-9-6(2)10-8(7)12(3)11-5/h4H,1-3H3 |
| InChIKey | BDBBFEBCNHBSMQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine?
The IUPAC name of 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine (CID 58861824) is 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine is Cc1ncc2c(C)nn(C)c2n1.
What is the InChIKey of 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine?
The InChIKey is BDBBFEBCNHBSMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-7-4-9-6(2)10-8(7)12(3)11-5/h4H,1-3H3.
What are the key properties of 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine?
1,3,6-trimethylpyrazolo[3,4-d]pyrimidine has a molecular weight of 162.20 g/mol, XLogP of 0.98, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3,6-trimethylpyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 58861824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).